Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-(2,4-Dihydroxyphenyl)-1,2-Hexanedione |
|---|---|
| Synonyms | 1-(2,4-dihydroxyphenyl)hexane-1,2-dione; NSC279884 |
| Molecular Structure |  |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 |
| CAS Registry Number | 501005-68-1 |
| SMILES | O=C(c1ccc(O)cc1O)C(=O)CCCC |
| InChI | 1S/C12H14O4/c1-2-3-4-10(14)12(16)9-6-5-8(13)7-11(9)15/h5-7,13,15H,2-4H2,1H3 |
| InChIKey | KNOULTNCRFHHED-UHFFFAOYSA-N |
| Density | 1.228g/cm3 (Cal.) |
|---|---|
| Boiling point | 385.793°C at 760 mmHg (Cal.) |
| Flash point | 201.292°C (Cal.) |
| Refractive index | 1.561 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2,4-Dihydroxyphenyl)-1,2-Hexanedione |