|
CAS#: 5019-57-8 Product: 5-Ethyl-3-(5-Nitro-2-Furyl)-1H-1,2,4-Triazole No suppilers available for the product. |
| Name | 5-Ethyl-3-(5-Nitro-2-Furyl)-1H-1,2,4-Triazole |
|---|---|
| Synonyms | 1H-1,2,4-Triazole, 3-ethyl-5-(5-nitro-2-furanyl)-; 3-Ethyl-5-(5-nitro-2-furyl)-4H-1,2,4-triazole #; 5-Ethyl-3-(5-nitrofuran-2-yl)-1H-1,2,4-triazole |
| Molecular Structure | ![]() |
| Molecular Formula | C8H8N4O3 |
| Molecular Weight | 208.17 |
| CAS Registry Number | 5019-57-8 |
| SMILES | O=[N+]([O-])c2oc(c1nnc(n1)CC)cc2 |
| InChI | 1S/C8H8N4O3/c1-2-6-9-8(11-10-6)5-3-4-7(15-5)12(13)14/h3-4H,2H2,1H3,(H,9,10,11) |
| InChIKey | QDBQYELDIPPGBA-UHFFFAOYSA-N |
| Density | 1.417g/cm3 (Cal.) |
|---|---|
| Boiling point | 432.637°C at 760 mmHg (Cal.) |
| Flash point | 215.451°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Ethyl-3-(5-Nitro-2-Furyl)-1H-1,2,4-Triazole |