|
CAS#: 50296-60-1 Product: 3,5-Dimethyl-1H-Pyrrole-2,4-Dicarboxylicacid 4-Methyl ester No suppilers available for the product. |
| Name | 3,5-Dimethyl-1H-Pyrrole-2,4-Dicarboxylicacid 4-Methyl ester |
|---|---|
| Synonyms | 4-Carbomethoxy-3,5-Dimethyl-1H-Pyrrole-2-Carboxylate; Zinc02643995 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H10NO4 |
| Molecular Weight | 196.18 |
| CAS Registry Number | 50296-60-1 |
| SMILES | CC1=C([NH]C(=C1C(OC)=O)C)C([O-])=O |
| InChI | 1S/C9H11NO4/c1-4-6(9(13)14-3)5(2)10-7(4)8(11)12/h10H,1-3H3,(H,11,12)/p-1 |
| InChIKey | LEZHGGAPMRGBOP-UHFFFAOYSA-M |
| Boiling point | 419.741°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 207.652°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5-Dimethyl-1H-Pyrrole-2,4-Dicarboxylicacid 4-Methyl ester |