Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Isopropyl(Trifluoromethyl)Peroxyanhydride |
|---|---|
| Synonyms | 2,2,2-trifluoroacetic isobutyric peroxyanhydride |
| Molecular Structure |  |
| Molecular Formula | C6H7F3O4 |
| Molecular Weight | 200.11 |
| CAS Registry Number | 503187-91-5 |
| SMILES | CC(C)C(=O)OOC(=O)C(F)(F)F |
| InChI | 1S/C6H7F3O4/c1-3(2)4(10)12-13-5(11)6(7,8)9/h3H,1-2H3 |
| InChIKey | GVUDMXLAQBFAFQ-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 123.5±50.0°C at 760 mmHg (Cal.) |
| Flash point | 28.6±25.0°C (Cal.) |
| Refractive index | 1.365 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Isopropyl(Trifluoromethyl)Peroxyanhydride |