Online Database of Chemicals from Around the World
|
CAS#: 50371-29-4 Product: 3-Bromomethylmenadione No suppilers available for the product. |
| Name | 3-Bromomethylmenadione |
|---|---|
| Synonyms | 2-(Bromomethyl)-3-Methyl-Naphthalene-1,4-Dione; 2-(Bromomethyl)-3-Methyl-1,4-Naphthoquinone; 1,4-Naphthalenedione, 2-(Bromomethyl)-3-Methyl- |
| Molecular Structure |  |
| Molecular Formula | C12H9BrO2 |
| Molecular Weight | 265.11 |
| CAS Registry Number | 50371-29-4 |
| SMILES | C1=CC=CC2=C1C(C(=C(C)C2=O)CBr)=O |
| InChI | 1S/C12H9BrO2/c1-7-10(6-13)12(15)9-5-3-2-4-8(9)11(7)14/h2-5H,6H2,1H3 |
| InChIKey | DRDSRFKIEAPYHY-UHFFFAOYSA-N |
| Density | 1.534g/cm3 (Cal.) |
|---|---|
| Boiling point | 358.437°C at 760 mmHg (Cal.) |
| Flash point | 118.965°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Bromomethylmenadione |