Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1,2,3-Trichloronaphthalene |
|---|---|
| Synonyms | Naphthalene, 1,2,3-Trichloro-; Naphthalene, 1,2,3-Trichloro |
| Molecular Structure |  |
| Molecular Formula | C10H5Cl3 |
| Molecular Weight | 231.51 |
| CAS Registry Number | 50402-52-3 |
| SMILES | C2=CC1=C(C(=C(C=C1C=C2)Cl)Cl)Cl |
| InChI | 1S/C10H5Cl3/c11-8-5-6-3-1-2-4-7(6)9(12)10(8)13/h1-5H |
| InChIKey | QEPTXDCPBXMWJC-UHFFFAOYSA-N |
| Density | 1.452g/cm3 (Cal.) |
|---|---|
| Boiling point | 303.8889-353.8889°C (Expl.) |
| 332.861°C at 760 mmHg (Cal.) | |
| Flash point | 228.469°C (Cal.) |
| solubility | Insoluble |
| Market Analysis Reports |
| List of Reports Available for 1,2,3-Trichloronaphthalene |