Online Database of Chemicals from Around the World
|
CAS#: 50590-08-4 Product: 3,5-Dichloro-4-Nitrophenol No suppilers available for the product. |
| Name | 3,5-Dichloro-4-Nitrophenol |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C6H3Cl2NO3 |
| Molecular Weight | 208.00 |
| CAS Registry Number | 50590-08-4 |
| SMILES | O=[N+]([O-])c1c(Cl)cc(O)cc1Cl |
| InChI | 1S/C6H3Cl2NO3/c7-4-1-3(10)2-5(8)6(4)9(11)12/h1-2,10H |
| InChIKey | GETDFRCRBVJZCK-UHFFFAOYSA-N |
| Density | 1.683g/cm3 (Cal.) |
|---|---|
| Boiling point | 357.414°C at 760 mmHg (Cal.) |
| Flash point | 169.958°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5-Dichloro-4-Nitrophenol |