Online Database of Chemicals from Around the World
|
CAS#: 50763-67-2 Product: (+)-trans-Nootkatol No suppilers available for the product. |
| Name | (+)-trans-Nootkatol |
|---|---|
| Synonyms | (2S,4R,4As,6R)-6-Isopropenyl-4,4A-Dimethyl-3,4,5,6,7,8-Hexahydro-2H-Naphthalen-2-Ol |
| Molecular Structure |  |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.35 |
| CAS Registry Number | 50763-67-2 |
| SMILES | [C@]12(C(=C[C@H](C[C@H]1C)O)CC[C@H](C2)C(=C)C)C |
| InChI | 1S/C15H24O/c1-10(2)12-5-6-13-8-14(16)7-11(3)15(13,4)9-12/h8,11-12,14,16H,1,5-7,9H2,2-4H3/t11-,12-,14+,15+/m1/s1 |
| InChIKey | GFNWRKNVTHDNPV-UXOAXIEHSA-N |
| Density | 0.973g/cm3 (Cal.) |
|---|---|
| Boiling point | 316.82°C at 760 mmHg (Cal.) |
| Flash point | 131.169°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (+)-trans-Nootkatol |