Online Database of Chemicals from Around the World
|
CAS#: 50817-72-6 Product: 4-Chloro-1H,3H-Naphtho[1,8-cd]Pyran-1,3-Dione No suppilers available for the product. |
| Name | 4-Chloro-1H,3H-Naphtho[1,8-cd]Pyran-1,3-Dione |
|---|---|
| Synonyms | 4-Chloro-1H,3H-Naphtho(1,8-Cd)Pyran-1,3-Dione |
| Molecular Structure | ![CAS#: 50817-72-6， 4-Chloro-1H,3H-Naphtho[1,8-cd]Pyran-1,3-Dione](/moreStructures/50817-72-6.gif) |
| Molecular Formula | C12H5ClO3 |
| Molecular Weight | 232.62 |
| CAS Registry Number | 50817-72-6 |
| EINECS | 256-788-3 |
| SMILES | C1=CC3=C2C(=C1Cl)C(OC(C2=CC=C3)=O)=O |
| InChI | 1S/C12H5ClO3/c13-8-5-4-6-2-1-3-7-9(6)10(8)12(15)16-11(7)14/h1-5H |
| InChIKey | ORYGDXAYCHIBLC-UHFFFAOYSA-N |
| Density | 1.565g/cm3 (Cal.) |
|---|---|
| Boiling point | 429.702°C at 760 mmHg (Cal.) |
| Flash point | 197.398°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chloro-1H,3H-Naphtho[1,8-cd]Pyran-1,3-Dione |