| Fenhe Chemical Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.fenhechem.com | |||
![]() | +86 (021) 3392-6068 | |||
![]() | julius.wei@fenhechem.com | |||
| Chemical manufacturer since 1997 | ||||
| chemBlink Standard supplier since 2024 | ||||
| Classification | Pharmaceutical intermediate >> Heterocyclic compound intermediate >> Pyrimidine compound >> Amine |
|---|---|
| Name | 5,6-Diethoxy-1,3-benzothiazol-2-amine |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14N2O2S |
| Molecular Weight | 238.31 |
| CAS Registry Number | 50850-95-8 |
| SMILES | CCOC1=C(C=C2C(=C1)N=C(S2)N)OCC |
|
5,6-Diethoxy-1,3-benzothiazol-2-amine is a noteworthy chemical compound distinguished by its unique structure and versatile applications in research and industry. This molecule features a benzothiazole ring system with ethoxy groups and an amine substituent, which collectively contribute to its distinctive chemical behavior and potential uses. The discovery of 5,6-Diethoxy-1,3-benzothiazol-2-amine emerged from efforts to explore the properties and reactivity of substituted benzothiazole derivatives. The benzothiazole ring system, which consists of a fused benzene and thiazole ring, is well-regarded for its stability and reactivity. The introduction of two ethoxy groups at positions 5 and 6, along with an amine group at position 2, enhances the molecule’s chemical versatility. In medicinal chemistry, 5,6-Diethoxy-1,3-benzothiazol-2-amine is being investigated for its potential therapeutic applications. The benzothiazole core is known for its various biological activities, including antimicrobial and anticancer effects. The ethoxy groups and the amine group can influence the molecule’s interaction with biological targets, potentially leading to new drug candidates. Researchers are evaluating how these modifications affect the compound’s biological activity, aiming to develop novel therapeutics with improved efficacy and selectivity. Beyond its medicinal applications, 5,6-Diethoxy-1,3-benzothiazol-2-amine is also valuable in materials science. Its ability to act as a versatile intermediate in chemical synthesis makes it useful for creating new materials. The compound can be employed in the development of organic electronics, specialty polymers, and coatings. Its functional groups allow it to participate in reactions that produce materials with tailored properties, making it an important tool in material innovation. The compound’s structure also enables it to serve as a reactive intermediate in organic synthesis. Its ethoxy and amine groups can participate in a range of chemical transformations, facilitating the creation of complex molecules. This property makes 5,6-Diethoxy-1,3-benzothiazol-2-amine a valuable reagent for chemists working on new synthetic routes and novel compounds. In summary, 5,6-Diethoxy-1,3-benzothiazol-2-amine is a compound with significant potential due to its unique structure and reactivity. Its applications in medicinal chemistry, materials science, and organic synthesis underscore its importance in advancing research and development across multiple scientific fields. |
| Market Analysis Reports |