Online Database of Chemicals from Around the World
| Trylead Chemical Technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (571) 8708-6220 | |||
 |
info@trylead-chem.com | |||
| Chemical manufacturer since 2006 | ||||
| Name | 8,9-Dimethoxy-6(5H)-Phenanthridinone |
|---|---|
| Synonyms | 6(5H)-Phenanthridinone, 8,9-dimethoxy- |
| Molecular Structure |  |
| Molecular Formula | C15H13NO3 |
| Molecular Weight | 255.27 |
| CAS Registry Number | 50879-53-3 |
| SMILES | COc1cc2c3ccccc3NC(=O)c2cc1OC |
| InChI | 1S/C15H13NO3/c1-18-13-7-10-9-5-3-4-6-12(9)16-15(17)11(10)8-14(13)19-2/h3-8H,1-2H3,(H,16,17) |
| InChIKey | JSZDJKBYMGGQAL-UHFFFAOYSA-N |
| Density | 1.236g/cm3 (Cal.) |
|---|---|
| Boiling point | 367.057°C at 760 mmHg (Cal.) |
| Flash point | 175.79°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8,9-Dimethoxy-6(5H)-Phenanthridinone |