|
CAS#: 50883-25-5 Product: Trichlorobiphenylol No suppilers available for the product. |
| Name | Trichlorobiphenylol |
|---|---|
| Synonyms | 2,3,4-Trichloro-6-Phenyl-Phenol; (1,1'-Biphenyl)Ol, Trichloro-; Trichloro-(1,1'-Biphenyl)Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H7Cl3O |
| Molecular Weight | 273.55 |
| CAS Registry Number | 50883-25-5 |
| SMILES | C1=C(C(=C(C(=C1Cl)Cl)Cl)O)C2=CC=CC=C2 |
| InChI | 1S/C12H7Cl3O/c13-9-6-8(7-4-2-1-3-5-7)12(16)11(15)10(9)14/h1-6,16H |
| InChIKey | WPUZAIQIZBJLCV-UHFFFAOYSA-N |
| Density | 1.447g/cm3 (Cal.) |
|---|---|
| Boiling point | 362.258°C at 760 mmHg (Cal.) |
| Flash point | 172.888°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trichlorobiphenylol |