|
CAS#: 50910-35-5 Product: alpha-(4-Biphenylyl)-alpha-Phenyl-1-Piperidinepropanol Hydrochloride No suppilers available for the product. |
| Name | alpha-(4-Biphenylyl)-alpha-Phenyl-1-Piperidinepropanol Hydrochloride |
|---|---|
| Synonyms | 1-Phenyl-1-(4-Phenylphenyl)-3-(1-Piperidyl)Propan-1-Ol Hydrochloride; 1-Phenyl-1-(4-Phenylphenyl)-3-Piperidino-Propan-1-Ol Hydrochloride; 1-Phenyl-1-(4-Phenylphenyl)-3-Piperidin-1-Yl-Propan-1-Ol Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C26H30ClNO |
| Molecular Weight | 407.98 |
| CAS Registry Number | 50910-35-5 |
| SMILES | [H+].C3=C(C(O)(CCN1CCCCC1)C2=CC=CC=C2)C=CC(=C3)C4=CC=CC=C4.[Cl-] |
| InChI | 1S/C26H29NO.ClH/c28-26(24-12-6-2-7-13-24,18-21-27-19-8-3-9-20-27)25-16-14-23(15-17-25)22-10-4-1-5-11-22;/h1-2,4-7,10-17,28H,3,8-9,18-21H2;1H |
| InChIKey | SYGHGTWDMQVZPW-UHFFFAOYSA-N |
| Boiling point | 561.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 289.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha-(4-Biphenylyl)-alpha-Phenyl-1-Piperidinepropanol Hydrochloride |