| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | (Z)-2-Butenedioic acid monoethyl ester, polymer with methoxyethene |
|---|---|
| Synonyms | (Z)-4-Ethoxy-4-Oxo-But-2-Enoic Acid; Methoxyethylene; (Z)-4-Ethoxy-4-Oxobut-2-Enoic Acid; Methoxyethylene; (Z)-4-Ethoxy-4-Keto-But-2-Enoic Acid; Methoxyethylene |
| Molecular Structure | ![]() |
| Molecular Formula | C9H14O5 |
| Molecular Weight | 202.21 |
| CAS Registry Number | 50935-57-4 |
| SMILES | C(OC(=O)\C=C/C(=O)O)C.COC=C |
| InChI | 1S/C6H8O4.C3H6O/c1-2-10-6(9)4-3-5(7)8;1-3-4-2/h3-4H,2H2,1H3,(H,7,8);3H,1H2,2H3/b4-3-; |
| InChIKey | UVHQXWILFGUDTA-LNKPDPKZSA-N |
| Boiling point | 261.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 109.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (Z)-2-Butenedioic acid monoethyl ester, polymer with methoxyethene |