Online Database of Chemicals from Around the World
|
CAS#: 50993-68-5 Product: N-Desmethylpropyphenazone No suppilers available for the product. |
| Name | N-Desmethylpropyphenazone |
|---|---|
| Synonyms | 4-Isopropyl-5-Methyl-2-Phenyl-1H-Pyrazol-3-One; 3H-Pyrazol-3-One, 1,2-Dihydro-5-Methyl-4-(1-Methylethyl)-2-Phenyl-; N-Desmethylpropyphenazone |
| Molecular Structure |  |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 |
| CAS Registry Number | 50993-68-5 |
| SMILES | C2=C(N1NC(=C(C1=O)C(C)C)C)C=CC=C2 |
| InChI | 1S/C13H16N2O/c1-9(2)12-10(3)14-15(13(12)16)11-7-5-4-6-8-11/h4-9,14H,1-3H3 |
| InChIKey | JEROJODGMFWEAA-UHFFFAOYSA-N |
| Density | 1.093g/cm3 (Cal.) |
|---|---|
| Boiling point | 312.924°C at 760 mmHg (Cal.) |
| Flash point | 143.051°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Desmethylpropyphenazone |