Online Database of Chemicals from Around the World
|
CAS#: 510-69-0 Product: Vittatine No suppilers available for the product. |
| Name | Vittatine |
|---|---|
| Synonyms | Vittatine |
| Molecular Structure |  |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 |
| CAS Registry Number | 510-69-0 |
| SMILES | [C@@]245[C@@H](N(CC3=CC1=C(OCO1)C=C23)CC4)C[C@H](O)C=C5 |
| InChI | 1S/C16H17NO3/c18-11-1-2-16-3-4-17(15(16)6-11)8-10-5-13-14(7-12(10)16)20-9-19-13/h1-2,5,7,11,15,18H,3-4,6,8-9H2/t11-,15+,16+/m1/s1 |
| InChIKey | RPAORVSEYNOMBR-RLCCDNCMSA-N |
| Density | 1.436g/cm3 (Cal.) |
|---|---|
| Boiling point | 456.323°C at 760 mmHg (Cal.) |
| Flash point | 229.776°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Vittatine |