Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 3-(Triphenylplumbyl)-1H-Pyrazole |
|---|---|
| Synonyms | 3-(Triphenylplumbyl)-1H-Pyrazole |
| Molecular Structure |  |
| Molecular Formula | C21H18N2Pb |
| Molecular Weight | 505.59 |
| CAS Registry Number | 51105-45-4 |
| EINECS | 256-968-1 |
| SMILES | C1=N[NH]C(=C1)[Pb](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4 |
| InChI | 1S/3C6H5.C3H3N2.Pb/c3*1-2-4-6-5-3-1;1-2-4-5-3-1;/h3*1-5H;1-2H,(H,4,5); |
| InChIKey | UQHCYQRUUQBPAU-UHFFFAOYSA-N |
| Boiling point | 544.212°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 282.929°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(Triphenylplumbyl)-1H-Pyrazole |