Online Database of Chemicals from Around the World
|
CAS#: 51152-88-6 Product: S(+)-Mianserin No suppilers available for the product. |
| Name | S(+)-Mianserin |
|---|---|
| Synonyms | Dibenzo(C,F)Pyrazino(1,2-A)Azepine, 1,2,3,4,10,14B-Hexahydro-2-Methyl-, (14Bs)-; Pdsp2_001417 |
| Molecular Structure |  |
| Molecular Formula | C18H20N2 |
| Molecular Weight | 264.37 |
| CAS Registry Number | 51152-88-6 |
| SMILES | [C@H]14N(C3=C(CC2=C1C=CC=C2)C=CC=C3)CCN(C4)C |
| InChI | 1S/C18H20N2/c1-19-10-11-20-17-9-5-3-7-15(17)12-14-6-2-4-8-16(14)18(20)13-19/h2-9,18H,10-13H2,1H3/t18-/m1/s1 |
| InChIKey | UEQUQVLFIPOEMF-GOSISDBHSA-N |
| Density | 1.182g/cm3 (Cal.) |
|---|---|
| Boiling point | 411.295°C at 760 mmHg (Cal.) |
| Flash point | 186.098°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for S(+)-Mianserin |