Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | N-Phenyl-3-Thiophenesulfonamide |
|---|---|
| Synonyms | 3-Thiophenesulfonamide,N-phenyl-; N-phenylthiophene-3-sulfonamide |
| Molecular Structure |  |
| Molecular Formula | C10H9NO2S2 |
| Molecular Weight | 239.31 |
| CAS Registry Number | 51175-66-7 |
| SMILES | c1ccc(cc1)NS(=O)(=O)c2ccsc2 |
| InChI | 1S/C10H9NO2S2/c12-15(13,10-6-7-14-8-10)11-9-4-2-1-3-5-9/h1-8,11H |
| InChIKey | JZLZYLSKUJERIQ-UHFFFAOYSA-N |
| Density | 1.424g/cm3 (Cal.) |
|---|---|
| Boiling point | 392.688°C at 760 mmHg (Cal.) |
| Flash point | 191.291°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Phenyl-3-Thiophenesulfonamide |