Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 9-Azatricyclo[3.3.1.02,8]Nona-3,6-Diene-9-Carboxamide |
|---|---|
| Synonyms | 9-azatricyclo[3.3.1.02,8]nona-3,6-diene-9-carboxamide |
| Molecular Structure | ![CAS#: 51386-64-2， 9-Azatricyclo[3.3.1.0<Sup>2,8</Sup>]Nona-3,6-Diene-9-Carboxamide](/moreStructures/51386-64-2.gif) |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 |
| CAS Registry Number | 51386-64-2 |
| SMILES | C1=CC2C3C2N(C1C=C3)C(=O)N |
| InChI | 1S/C9H10N2O/c10-9(12)11-5-1-3-6-7(4-2-5)8(6)11/h1-8H,(H2,10,12) |
| InChIKey | JVWDBLQUZILUCN-UHFFFAOYSA-N |
| Density | 1.377g/cm3 (Cal.) |
|---|---|
| Boiling point | 307.432°C at 760 mmHg (Cal.) |
| Flash point | 139.73°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-Azatricyclo[3.3.1.02,8]Nona-3,6-Diene-9-Carboxamide |