|
CAS#: 5144-11-6 Product: 1,5-Dimethyltetrazole No suppilers available for the product. |
| Name | 1,5-Dimethyltetrazole |
|---|---|
| Synonyms | 1,5-Dimethyl-1,2,3,4-Tetrazole; Inchi=1/C3h6n4/C1-3-4-5-6-7(3)2/H1-2H; 1,5-Dimethyl-1H-Tetrazole |
| Molecular Structure | ![]() |
| Molecular Formula | C3H6N4 |
| Molecular Weight | 98.11 |
| CAS Registry Number | 5144-11-6 |
| EINECS | 225-913-3 |
| SMILES | CC1=NN=N[N]1C |
| InChI | 1S/C3H6N4/c1-3-4-5-6-7(3)2/h1-2H3 |
| InChIKey | HWHNFJYQDMSYAF-UHFFFAOYSA-N |
| Density | 1.308g/cm3 (Cal.) |
|---|---|
| Boiling point | 264.793°C at 760 mmHg (Cal.) |
| Flash point | 113.943°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,5-Dimethyltetrazole |