Online Database of Chemicals from Around the World
|
CAS#: 51483-39-7 Product: 1,3-Dichloro-2-Bromopropane No suppilers available for the product. |
| Name | 1,3-Dichloro-2-Bromopropane |
|---|---|
| Synonyms | 2-Bromo-1,3-Dichloro-Propane; Inchi=1/C3h5brcl2/C4-3(1-5)2-6/H3h,1-2H; Propane, 2-Bromo-1,3-Dichloro- |
| Molecular Structure |  |
| Molecular Formula | C3H5BrCl2 |
| Molecular Weight | 191.88 |
| CAS Registry Number | 51483-39-7 |
| SMILES | C(Cl)C(Br)CCl |
| InChI | 1S/C3H5BrCl2/c4-3(1-5)2-6/h3H,1-2H2 |
| InChIKey | PVYQWLHAHRIROF-UHFFFAOYSA-N |
| Density | 1.678g/cm3 (Cal.) |
|---|---|
| Boiling point | 167.044°C at 760 mmHg (Cal.) |
| Flash point | 61.996°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Dichloro-2-Bromopropane |