Online Database of Chemicals from Around the World
|
CAS#: 51496-03-8 Product: Diisopropyl phenyl phosphate No suppilers available for the product. |
| Name | Diisopropyl phenyl phosphate |
|---|---|
| Synonyms | (2,3-Diisopropylphenyl) Dihydrogen Phosphate; Diprphp; Phosphoric Acid, Bis(1-Methylethyl)Phenyl Ester |
| Molecular Structure |  |
| Molecular Formula | C12H19O4P |
| Molecular Weight | 258.25 |
| CAS Registry Number | 51496-03-8 |
| SMILES | C1=C(C(=C(C(C)C)C=C1)C(C)C)O[P](=O)(O)O |
| InChI | 1S/C12H19O4P/c1-8(2)10-6-5-7-11(12(10)9(3)4)16-17(13,14)15/h5-9H,1-4H3,(H2,13,14,15) |
| InChIKey | SFFTXLYPBWITRH-UHFFFAOYSA-N |
| Density | 1.194g/cm3 (Cal.) |
|---|---|
| Boiling point | 384.464°C at 760 mmHg (Cal.) |
| Flash point | 186.317°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diisopropyl phenyl phosphate |