|
CAS#: 51498-07-8 Product: alpha-Methyl-3-Biphenylacetic Acid No suppilers available for the product. |
| Name | alpha-Methyl-3-Biphenylacetic Acid |
|---|---|
| Synonyms | 2-(3-Phenylphenyl)Propionic Acid; 3-Biphenylacetic Acid, Alpha-Methyl-; Brn 5007839 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.27 |
| CAS Registry Number | 51498-07-8 |
| SMILES | C1=C(C=CC=C1C2=CC=CC=C2)C(C(O)=O)C |
| InChI | 1S/C15H14O2/c1-11(15(16)17)13-8-5-9-14(10-13)12-6-3-2-4-7-12/h2-11H,1H3,(H,16,17) |
| InChIKey | OQMCVCHIWJWEHF-UHFFFAOYSA-N |
| Density | 1.135g/cm3 (Cal.) |
|---|---|
| Boiling point | 395.88°C at 760 mmHg (Cal.) |
| Flash point | 292.697°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha-Methyl-3-Biphenylacetic Acid |