Online Database of Chemicals from Around the World
Methyl 2,2,3,3-Tetrafluoro-3-[(1,1,1,2,3,3,3-Heptafluoro-2-Propanyl)Oxy]Propanoate
[CAS# 51502-43-3]
Identification
| Name |
Methyl 2,2,3,3-Tetrafluoro-3-[(1,1,1,2,3,3,3-Heptafluoro-2-Propanyl)Oxy]Propanoate |
|---|
| Synonyms |
Methyl 3-(heptafluoroisopropoxy)tetrafluoropropionate; Methyl perfluoro-5-methyl-4-oxahexanoate 97+%; methyl-3-(heptafluoroisopropoxy)tetrafluoropropionate |
|
| Molecular Structure |
![CAS#: 51502-43-3， Methyl 2,2,3,3-Tetrafluoro-3-[(1,1,1,2,3,3,3-Heptafluoro-2-Propanyl)Oxy]Propanoate](/moreStructures/51502-43-3.gif) |
| Molecular Formula |
C7H3F11O3 |
| Molecular Weight |
344.08 |
| CAS Registry Number |
51502-43-3 |
| SMILES |
FC(F)(C(=O)OC)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)F |
| InChI |
1S/C7H3F11O3/c1-20-2(19)3(8,9)7(17,18)21-4(10,5(11,12)13)6(14,15)16/h1H3 |
| InChIKey |
ZIBMBDGKVCYGHR-UHFFFAOYSA-N |
|
Properties
| Density |
1.607g/cm3 (Cal.) |
|---|
| Boiling point |
111°C (Expl.) |
|
189.466°C at 760 mmHg (Cal.) |
| Flash point |
66.88°C (Cal.) |
|
Safety Data
| Safety Description |
Irritant |
|---|
|
R36/37/38 |
|
S23,S24/25,S36/37/39,S45 |
| SDS |
Available |
|
Related Products
N-Methyl-N-Tetr... Methyl 5-Tetrad... Methyl 9-Tetrad... Methyl (19E)-2,... Methyl 4,5,6,7-... Methyl 4-(1,1,2... 2-Methyl-1-(1,1... 2-Methyl-3-(1,1... N-Methyl-N-(1,1... 4-[2-[3-Methyl-... Methyl Tetraflu... Methyl 2,2,3,3-... N-Methyltetrafl... 1-Methyl-2,2,3,... Methyl 2,2,3,3-... Methyl tetrahyd... N-Methyl-5,6,7,... 2-Methyl-1,2,3,... 1-(2-Methyl-4,5... (4aR,7aR)-4-Met...
