Online Database of Chemicals from Around the World
|
CAS#: 51528-37-1 Product: Ethylmethylphosphinic Anhydride No suppilers available for the product. |
| Name | Ethylmethylphosphinic Anhydride |
|---|---|
| Synonyms | 1-[(Ethyl-Methyl-Phosphoryl)Oxy-Methyl-Phosphoryl]Ethane; Ethylmethylphosphinic Anhydride |
| Molecular Structure |  |
| Molecular Formula | C6H16O3P2 |
| Molecular Weight | 198.14 |
| CAS Registry Number | 51528-37-1 |
| EINECS | 257-255-8 |
| SMILES | C([P](O[P](=O)(CC)C)(=O)C)C |
| InChI | 1S/C6H16O3P2/c1-5-10(3,7)9-11(4,8)6-2/h5-6H2,1-4H3 |
| InChIKey | LLUBVCCZUMPBMI-UHFFFAOYSA-N |
| Density | 1.087g/cm3 (Cal.) |
|---|---|
| Boiling point | 246.197°C at 760 mmHg (Cal.) |
| Flash point | 116.787°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethylmethylphosphinic Anhydride |