Online Database of Chemicals from Around the World
|
CAS#: 51550-58-4 Product: Isopropyl 2-(2,4,5-Trichlorophenoxy)Propionate No suppilers available for the product. |
| Name | Isopropyl 2-(2,4,5-Trichlorophenoxy)Propionate |
|---|---|
| Synonyms | Isopropyl 2-(2,4,5-Trichlorophenoxy)Propanoate; 2-(2,4,5-Trichlorophenoxy)Propanoic Acid Isopropyl Ester; 2-(2,4,5-Trichlorophenoxy)Propionic Acid Isopropyl Ester |
| Molecular Structure |  |
| Molecular Formula | C12H13Cl3O3 |
| Molecular Weight | 311.59 |
| CAS Registry Number | 51550-58-4 |
| EINECS | 257-275-7 |
| SMILES | C1=C(Cl)C(=CC(=C1OC(C(OC(C)C)=O)C)Cl)Cl |
| InChI | 1S/C12H13Cl3O3/c1-6(2)17-12(16)7(3)18-11-5-9(14)8(13)4-10(11)15/h4-7H,1-3H3 |
| InChIKey | HVUJPGRBJNSQCB-UHFFFAOYSA-N |
| Density | 1.32g/cm3 (Cal.) |
|---|---|
| Boiling point | 360.594°C at 760 mmHg (Cal.) |
| Flash point | 136.032°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Isopropyl 2-(2,4,5-Trichlorophenoxy)Propionate |