Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 1-Hydroxyprop-2-Yl Benzoate |
|---|---|
| Synonyms | (2-Hydroxy-1-Methyl-Ethyl) Benzoate; Benzoic Acid (2-Hydroxy-1-Methylethyl) Ester; Benzoic Acid (2-Hydroxy-1-Methyl-Ethyl) Ester |
| Molecular Structure |  |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 |
| CAS Registry Number | 51591-52-7 |
| EINECS | 257-304-3 |
| SMILES | C1=C(C(OC(CO)C)=O)C=CC=C1 |
| InChI | 1S/C10H12O3/c1-8(7-11)13-10(12)9-5-3-2-4-6-9/h2-6,8,11H,7H2,1H3 |
| InChIKey | LBPLLQWWWCNJBE-UHFFFAOYSA-N |
| Density | 1.139g/cm3 (Cal.) |
|---|---|
| Boiling point | 295.193°C at 760 mmHg (Cal.) |
| Flash point | 125.141°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Hydroxyprop-2-Yl Benzoate |