|
CAS#: 516-16-5 Product: 3-beta,11-beta,21-Trihydroxy-5-alpha-Pregnan-20-One No suppilers available for the product. |
| Name | 3-beta,11-beta,21-Trihydroxy-5-alpha-Pregnan-20-One |
|---|---|
| Synonyms | 1-(3,11-Dihydroxy-10,13-Dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-Tetradecahydro-1H-Cyclopenta[A]Phenanthren-17-Yl)-2-Hydroxy-Ethanone; Nsc112288; Allopregnane-3 Beta,11 Beta,21-Triol-20-One |
| Molecular Structure | ![]() |
| Molecular Formula | C21H34O4 |
| Molecular Weight | 350.50 |
| CAS Registry Number | 516-16-5 |
| SMILES | C(C(C4C3(C(C2C(C1(C(CC(O)CC1)CC2)C)C(C3)O)CC4)C)=O)O |
| InChI | 1S/C21H34O4/c1-20-8-7-13(23)9-12(20)3-4-14-15-5-6-16(18(25)11-22)21(15,2)10-17(24)19(14)20/h12-17,19,22-24H,3-11H2,1-2H3 |
| InChIKey | RHQQHZQUAMFINJ-UHFFFAOYSA-N |
| Density | 1.181g/cm3 (Cal.) |
|---|---|
| Boiling point | 509.576°C at 760 mmHg (Cal.) |
| Flash point | 276.07°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-beta,11-beta,21-Trihydroxy-5-alpha-Pregnan-20-One |