| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Name | Diphenylthiirene 1,1-Dioxide |
|---|---|
| Synonyms | 2,3-Diphenylthiirene 1,1-Dioxide; 2,3-Diphenylthiirene 1-Oxide; 2,3-Diphenylthiirene Dioxide |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10O2S |
| Molecular Weight | 242.29 |
| CAS Registry Number | 5162-99-2 |
| SMILES | C1=CC=CC=C1C2=C([S]2(=O)=O)C3=CC=CC=C3 |
| InChI | 1S/C14H10O2S/c15-17(16)13(11-7-3-1-4-8-11)14(17)12-9-5-2-6-10-12/h1-10H |
| InChIKey | FVDCQEMOBAKISG-UHFFFAOYSA-N |
| Density | 1.365g/cm3 (Cal.) |
|---|---|
| Boiling point | 476.591°C at 760 mmHg (Cal.) |
| Flash point | 316.849°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diphenylthiirene 1,1-Dioxide |