Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 3,6-Dihydroxyphthalimide |
|---|---|
| Synonyms | 4,7-Dihydroxyisoindoline-1,3-Dione; 4,7-Dihydroxyisoindoline-1,3-Quinone; Nsc229301 |
| Molecular Structure |  |
| Molecular Formula | C8H5NO4 |
| Molecular Weight | 179.13 |
| CAS Registry Number | 51674-11-4 |
| EINECS | 257-344-1 |
| SMILES | C1=CC(=C2C(=C1O)C(=O)NC2=O)O |
| InChI | 1S/C8H5NO4/c10-3-1-2-4(11)6-5(3)7(12)9-8(6)13/h1-2,10-11H,(H,9,12,13) |
| InChIKey | RTVQVYVJANLNSR-UHFFFAOYSA-N |
| Density | 1.716g/cm3 (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3,6-Dihydroxyphthalimide |