Online Database of Chemicals from Around the World
|
CAS#: 517-82-8 Product: Echinochrome A No suppilers available for the product. |
| Name | Echinochrome A |
|---|---|
| Synonyms | 6-Ethyl-1,4,5,7,8-Pentahydroxy-Naphthalene-2,3-Dione; 6-Ethyl-1,4,5,7,8-Pentahydroxy-2,3-Naphthoquinone; 2-Ethyl-3,5,6,7,8-Pentahydroxy-[1,4]Naphthoquinone |
| Molecular Structure |  |
| Molecular Formula | C12H10O7 |
| Molecular Weight | 266.21 |
| CAS Registry Number | 517-82-8 |
| SMILES | C(C2=C(O)C1=C(O)C(=O)C(=O)C(=C1C(=C2O)O)O)C |
| InChI | 1S/C12H10O7/c1-2-3-6(13)4-5(8(15)7(3)14)10(17)12(19)11(18)9(4)16/h13-17H,2H2,1H3 |
| InChIKey | DZGNJLNMQRKTLC-UHFFFAOYSA-N |
| Density | 1.861g/cm3 (Cal.) |
|---|---|
| Boiling point | 197.341°C at 760 mmHg (Cal.) |
| Flash point | 87.446°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Echinochrome A |