Online Database of Chemicals from Around the World
|
CAS#: 518-60-5 Product: [8S,(-)]-7,10-Dihydro-10-Methyl-8-(1-Methylethyl)-1,3-Dioxolo[4,5-h]Furo[2,3-B]Quinoline-6(8H)-One No suppilers available for the product. |
| Name | [8S,(-)]-7,10-Dihydro-10-Methyl-8-(1-Methylethyl)-1,3-Dioxolo[4,5-h]Furo[2,3-B]Quinoline-6(8H)-One |
|---|---|
| Synonyms | Lunine; Lunine, (-)-; Nsc77153 |
| Molecular Structure | ![CAS#: 518-60-5， [8S,(-)]-7,10-Dihydro-10-Methyl-8-(1-Methylethyl)-1,3-Dioxolo[4,5-h]Furo[2,3-B]Quinoline-6(8H)-One](/moreStructures/518-60-5.gif) |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 |
| CAS Registry Number | 518-60-5 |
| SMILES | C1=CC4=C(C2=C1C(C3=C(N2C)OC(C(C)C)C3)=O)OCO4 |
| InChI | 1S/C16H17NO4/c1-8(2)12-6-10-14(18)9-4-5-11-15(20-7-19-11)13(9)17(3)16(10)21-12/h4-5,8,12H,6-7H2,1-3H3 |
| InChIKey | PPSOAEAJQYYWFV-UHFFFAOYSA-N |
| Density | 1.351g/cm3 (Cal.) |
|---|---|
| Boiling point | 427.599°C at 760 mmHg (Cal.) |
| Flash point | 212.405°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [8S,(-)]-7,10-Dihydro-10-Methyl-8-(1-Methylethyl)-1,3-Dioxolo[4,5-h]Furo[2,3-B]Quinoline-6(8H)-One |