Online Database of Chemicals from Around the World
| Atlantic Research Chemicals Ltd. | UK | Inquire | ||
|---|---|---|---|---|
 |
+44 (8707) 746-454 | |||
 |
info@atlantic-chemicals.com | |||
| Chemical manufacturer | ||||
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
|
+86 13417589054/ | |||
|
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4-Nitro-1H-Pyrazole-3-Carbonyl Chloride |
|---|---|
| Synonyms | 4-nitro-3-pyrazolecarbonyl chloride |
| Molecular Structure |  |
| Molecular Formula | C4H2ClN3O3 |
| Molecular Weight | 175.53 |
| CAS Registry Number | 518990-55-1 |
| SMILES | C1=C(C(=NN1)C(=O)Cl)[N+](=O)[O-] |
| InChI | 1S/C4H2ClN3O3/c5-4(9)3-2(8(10)11)1-6-7-3/h1H,(H,6,7) |
| InChIKey | RZBGKBIWPRUUTO-UHFFFAOYSA-N |
| Density | 1.8±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 411.6±25.0°C at 760 mmHg (Cal.) |
| Flash point | 202.7±23.2°C (Cal.) |
| Refractive index | 1.636 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-Nitro-1H-Pyrazole-3-Carbonyl Chloride |