Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Chlorinated Paraffin 52 |
|---|---|
| Synonyms | Chlorowax 500C; Ncgc00091156-01 |
| Molecular Structure |  |
| Molecular Formula | C10H16Cl6 |
| Molecular Weight | 348.95 |
| CAS Registry Number | 51990-12-6 |
| SMILES | C(C(C(C(C(C(C)Cl)Cl)Cl)Cl)Cl)C(CC)Cl |
| InChI | 1S/C10H16Cl6/c1-3-6(12)4-7(13)9(15)10(16)8(14)5(2)11/h5-10H,3-4H2,1-2H3 |
| InChIKey | GJGHBJCMOWRRSZ-UHFFFAOYSA-N |
| Density | 1.321g/cm3 (Cal.) |
|---|---|
| Boiling point | 399.872°C at 760 mmHg (Cal.) |
| Flash point | 190.959°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Chlorinated Paraffin 52 |