| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | Methyl 2-Hydroxy-4-Methoxy-6-Methylbenzoate |
|---|---|
| Synonyms | everninic acid methyl ester; Methyl 2-hydroxy-4-methoxy-6-methylbenzoate #; METHYL EVERNINATE |
| Molecular Structure | ![]() |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 |
| CAS Registry Number | 520-43-4 |
| SMILES | CC1=CC(=CC(=C1C(=O)OC)O)OC |
| InChI | 1S/C10H12O4/c1-6-4-7(13-2)5-8(11)9(6)10(12)14-3/h4-5,11H,1-3H3 |
| InChIKey | PFVPJOAAHSOENR-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 302.6±37.0°C at 760 mmHg (Cal.) |
| Flash point | 116.4±20.0°C (Cal.) |
| (1) | Merlini L., Mondelli R., Nasini G., Hesse Manfred. Structure of Wortmin, a new Metabolite fromPenicillium wortmanni, Helvetica Chimica Acta, 1973 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Methyl 2-Hydroxy-4-Methoxy-6-Methylbenzoate |