Online Database of Chemicals from Around the World
|
CAS#: 52005-46-6 Product: 4,5-Dichloro-2-Benzofuran-1,3-Dione No suppilers available for the product. |
| Name | 4,5-Dichloro-2-Benzofuran-1,3-Dione |
|---|---|
| Synonyms | 4,5-Dichloroisobenzofuran-1,3-Dione; 4,5-Dichloroisobenzofuran-1,3-Quinone; Dichlorophthalic Anhydride |
| Molecular Structure |  |
| Molecular Formula | C8H2Cl2O3 |
| Molecular Weight | 217.01 |
| CAS Registry Number | 52005-46-6 |
| EINECS | 257-594-1 |
| SMILES | C2=CC1=C(C(OC1=O)=O)C(=C2Cl)Cl |
| InChI | 1S/C8H2Cl2O3/c9-4-2-1-3-5(6(4)10)8(12)13-7(3)11/h1-2H |
| InChIKey | GAIPRQZXSYSCRD-UHFFFAOYSA-N |
| Density | 1.716g/cm3 (Cal.) |
|---|---|
| Boiling point | 328.805°C at 760 mmHg (Cal.) |
| Flash point | 153.625°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5-Dichloro-2-Benzofuran-1,3-Dione |