Online Database of Chemicals from Around the World
| Name | 4,8-Dioxo-2-Adamantanecarboxylic Acid |
|---|---|
| Synonyms | 2-Adamantanecarboxylic acid, 4,8-dioxo-; 4,8-Dioxo-2-adamantanecarboxylic acid; 4,8-Dioxo-2-adamantanecarboxylic acid # |
| Molecular Structure |  |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 |
| CAS Registry Number | 5202-69-7 |
| SMILES | O=C1C3CC2C(=O)C(CC1C2)C3C(=O)O |
| InChI | 1S/C11H12O4/c12-9-4-1-5-3-7(9)8(11(14)15)6(2-4)10(5)13/h4-8H,1-3H2,(H,14,15) |
| InChIKey | BIWVQMXEISELNT-UHFFFAOYSA-N |
| Density | 1.439g/cm3 (Cal.) |
|---|---|
| Boiling point | 446.191°C at 760 mmHg (Cal.) |
| Flash point | 237.779°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,8-Dioxo-2-Adamantanecarboxylic Acid |
