Online Database of Chemicals from Around the World
| Name | 3-Bromo-Acenaphthene |
|---|---|
| Synonyms | Ai3-00187; Acenaphthene, 3-Bromo-; Acenaphthylene, 3-Bromo-1,2-Dihydro- |
| Molecular Structure |  |
| Molecular Formula | C12H9Br |
| Molecular Weight | 233.11 |
| CAS Registry Number | 5209-31-4 |
| SMILES | C2=C(C3=C1C(=CC=CC1=C2)CC3)Br |
| InChI | 1S/C12H9Br/c13-11-7-5-9-3-1-2-8-4-6-10(11)12(8)9/h1-3,5,7H,4,6H2 |
| InChIKey | ZCKOLZGEKZZPDE-UHFFFAOYSA-N |
| Density | 1.543g/cm3 (Cal.) |
|---|---|
| Boiling point | 352.902°C at 760 mmHg (Cal.) |
| Flash point | 169.629°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Bromo-Acenaphthene |
