Online Database of Chemicals from Around the World
|
CAS#: 52172-18-6 Product: 7,8-Dioxochlorpromazine No suppilers available for the product. |
| Name | 7,8-Dioxochlorpromazine |
|---|---|
| Synonyms | 8-Chloro-10-(3-Dimethylaminopropyl)Phenothiazine-2,3-Quinone; 7,8-Dioxo-Cpz; 7,8-Dioxo-Chlorpromazine |
| Molecular Structure |  |
| Molecular Formula | C17H17ClN2O2S |
| Molecular Weight | 348.85 |
| CAS Registry Number | 52172-18-6 |
| SMILES | C1=C(Cl)C=CC3=C1N(C2=CC(=O)C(C=C2S3)=O)CCCN(C)C |
| InChI | 1S/C17H17ClN2O2S/c1-19(2)6-3-7-20-12-8-11(18)4-5-16(12)23-17-10-15(22)14(21)9-13(17)20/h4-5,8-10H,3,6-7H2,1-2H3 |
| InChIKey | LKAIPUXDAHHJLG-UHFFFAOYSA-N |
| Density | 1.393g/cm3 (Cal.) |
|---|---|
| Boiling point | 439.785°C at 760 mmHg (Cal.) |
| Flash point | 219.774°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7,8-Dioxochlorpromazine |