| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Biosynth AG. | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (71) 858-2020 | |||
![]() |
welcome@biosynth.ch | |||
| Chemical manufacturer | ||||
| Classification | Analytical chemistry >> Standard >> Forensic and veterinary standards |
|---|---|
| Name | Ethylhydrocupreine |
| Synonyms | (R)-(6-Ethoxy-4-Quinolyl)-[(2S,5R)-5-Ethyl-2,5-Dimethyl-Quinuclidin-2-Yl]Methanol Hydrochloride; (R)-(6-Ethoxy-4-Quinolyl)-[(2S,5R)-5-Ethyl-2,5-Dimethyl-2-Quinuclidinyl]Methanol Hydrochloride; Cinchonan-9-Ol, 6'-Ethoxy-10,11-Dihydro-, Monohydrochloride, (8Alpha,9R)- (9Ci) |
| Molecular Structure | ![]() |
| Molecular Formula | C23H33ClN2O2 |
| Molecular Weight | 404.98 |
| CAS Registry Number | 522-60-1 |
| EINECS | 208-333-5 |
| SMILES | [C@@]1(C2C[C@](N(C1)CC2)([C@H](O)C3=C4C(=NC=C3)C=CC(=C4)OCC)C)(CC)C.[H+].[Cl-] |
| InChI | 1S/C23H32N2O2.ClH/c1-5-22(3)15-25-12-10-16(22)14-23(25,4)21(26)18-9-11-24-20-8-7-17(27-6-2)13-19(18)20;/h7-9,11,13,16,21,26H,5-6,10,12,14-15H2,1-4H3;1H/t16?,21-,22+,23+;/m1./s1 |
| InChIKey | UBGKQKTVBOWPKR-BVMFEKKJSA-N |
| Boiling point | 509.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 261.8°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Ethylhydrocupreine |