| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() | www.purerechem.com | |||
![]() | +86 (551) 6288-8437 +86 18096409024 | |||
![]() | info@purerechem.com | |||
![]() | QQ Chat | |||
![]() | Skype Chat | |||
![]() | WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Classification | Analytical chemistry >> Standard >> Pharmacopoeia standards and magazine standards |
|---|---|
| Name | Diazepam EP Impurity C |
| Synonyms | 3-amino-6-chloro-1-methyl-4-phenylquinolin-2-one |
| Molecular Structure | ![]() |
| Molecular Formula | C16H13ClN2O |
| Molecular Weight | 284.74 |
| CAS Registry Number | 5220-02-0 |
| EC Number | 641-550-7 |
| SMILES | CN1C2=C(C=C(C=C2)Cl)C(=C(C1=O)N)C3=CC=CC=C3 |
| Solubility | 68.98 mg/L (25 °C water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.653, Calc.* |
| Melting point | 183.77 °C |
| Boiling Point | 438.28 °C, 436.3±45.0 °C (760 mmHg), Calc.* |
| Flash Point | 217.7±28.7 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Classification | |||||||||
|---|---|---|---|---|---|---|---|---|---|
| |||||||||
| SDS | Available | ||||||||
| Market Analysis Reports |
| List of Reports Available for Diazepam EP Impurity C |