Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4-Indanesulfonamide |
|---|---|
| Synonyms | 2,3-dihydro-1H-indene-4-sulfonamide |
| Molecular Structure |  |
| Molecular Formula | C9H11NO2S |
| Molecular Weight | 197.25 |
| CAS Registry Number | 52205-82-0 |
| SMILES | c1cc2c(c(c1)S(=O)(=O)N)CCC2 |
| InChI | 1S/C9H11NO2S/c10-13(11,12)9-6-2-4-7-3-1-5-8(7)9/h2,4,6H,1,3,5H2,(H2,10,11,12) |
| InChIKey | PYPVLVBCGQKOMW-UHFFFAOYSA-N |
| Density | 1.338g/cm3 (Cal.) |
|---|---|
| Boiling point | 398.495°C at 760 mmHg (Cal.) |
| Flash point | 194.803°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Indanesulfonamide |