Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3-Chloro-2,4-Biphenyldiol |
|---|---|
| Synonyms | [1,1-Biphenyl]-2,4-diol,3-chloro-; 3-chloro-[1,1'-biphenyl]-2,4-diol |
| Molecular Structure |  |
| Molecular Formula | C12H9ClO2 |
| Molecular Weight | 220.65 |
| CAS Registry Number | 522629-58-9 |
| SMILES | c1ccc(cc1)c2ccc(c(c2O)Cl)O |
| InChI | 1S/C12H9ClO2/c13-11-10(14)7-6-9(12(11)15)8-4-2-1-3-5-8/h1-7,14-15H |
| InChIKey | ZJHCPEUNGDLOOI-UHFFFAOYSA-N |
| Density | 1.349g/cm3 (Cal.) |
|---|---|
| Boiling point | 337.245°C at 760 mmHg (Cal.) |
| Flash point | 157.76°C (Cal.) |
| Refractive index | 1.648 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Chloro-2,4-Biphenyldiol |