Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Cobalt(2+) Neodecanoate |
|---|---|
| Synonyms | Cobaltous 3,3,5,5-Tetramethylhexanoate; Neodecanoic Acid, Cobalt(2+) Salt |
| Molecular Structure |  |
| Molecular Formula | C20H38CoO4 |
| Molecular Weight | 401.45 |
| CAS Registry Number | 52270-44-7 |
| EINECS | 257-798-0 |
| SMILES | C(C(CC([O-])=O)(C)C)C(C)(C)C.C(C(CC([O-])=O)(C)C)C(C)(C)C.[Co++] |
| InChI | 1S/2C10H20O2.Co/c2*1-9(2,3)7-10(4,5)6-8(11)12;/h2*6-7H2,1-5H3,(H,11,12);/q;;+2/p-2 |
| InChIKey | JJRMUHZMYSOFBB-UHFFFAOYSA-L |
| Boiling point | 256.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 114.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Cobalt(2+) Neodecanoate |