Online Database of Chemicals from Around the World
|
CAS#: 52317-07-4 Product: 2-Hydroxypropyl 5-Oxo-L-Prolinate No suppilers available for the product. |
| Name | 2-Hydroxypropyl 5-Oxo-L-Prolinate |
|---|---|
| Synonyms | (2R)-5-Oxo-2-Pyrrolidinecarboxylic Acid 2-Hydroxypropyl Ester; (2R)-5-Ketopyrrolidine-2-Carboxylic Acid 2-Hydroxypropyl Ester; 2-Hydroxypropyl 5-Oxo-L-Prolinate |
| Molecular Structure |  |
| Molecular Formula | C8H13NO4 |
| Molecular Weight | 187.20 |
| CAS Registry Number | 52317-07-4 |
| EINECS | 257-846-0 |
| SMILES | [C@H]1(NC(=O)CC1)C(OCC(O)C)=O |
| InChI | 1S/C8H13NO4/c1-5(10)4-13-8(12)6-2-3-7(11)9-6/h5-6,10H,2-4H2,1H3,(H,9,11)/t5?,6-/m1/s1 |
| InChIKey | CSLLYODGQWBRHX-PRJDIBJQSA-N |
| Density | 1.25g/cm3 (Cal.) |
|---|---|
| Boiling point | 436.137°C at 760 mmHg (Cal.) |
| Flash point | 217.568°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Hydroxypropyl 5-Oxo-L-Prolinate |