Online Database of Chemicals from Around the World
|
CAS#: 5235-83-6 Product: N,N-Dimethyl-N'-Naphthylpropane-1,3-Diamine No suppilers available for the product. |
| Name | N,N-Dimethyl-N'-Naphthylpropane-1,3-Diamine |
|---|---|
| Synonyms | 3-Pent-4-Enyl-3-Phenyl-Benzofuran-2-One; 3-Pent-4-Enyl-3-Phenyl-2-Benzofuranone; Nsc333414 |
| Molecular Structure |  |
| Molecular Formula | C19H18O2 |
| Molecular Weight | 278.35 |
| CAS Registry Number | 5235-83-6 |
| EINECS | 226-034-8 |
| SMILES | C1=CC=CC2=C1C(CCCC=C)(C(O2)=O)C3=CC=CC=C3 |
| InChI | 1S/C19H18O2/c1-2-3-9-14-19(15-10-5-4-6-11-15)16-12-7-8-13-17(16)21-18(19)20/h2,4-8,10-13H,1,3,9,14H2 |
| InChIKey | CRRREAYCSHGOKI-UHFFFAOYSA-N |
| Density | 1.11g/cm3 (Cal.) |
|---|---|
| Boiling point | 386.379°C at 760 mmHg (Cal.) |
| Flash point | 162.441°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Dimethyl-N'-Naphthylpropane-1,3-Diamine |