| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() | www.bocsci.com | |||
![]() | +1 (631) 485-4226 | |||
![]() | +1 (631) 614-7828 | |||
![]() | info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink Standard supplier since 2010 | ||||
| Classification | Biochemical >> Nucleoside drugs >> Nucleotides and their analogues |
|---|---|
| Name | 5-Hydroxymethyldeoxyuridylate |
| Synonyms | [(3S,5R)-3-hydroxy-5-[5-(hydroxymethyl)-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl dihydrogen phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H15N2O9P |
| Molecular Weight | 338.21 |
| CAS Registry Number | 5238-86-8 |
| SMILES | C1[C@@H](C(O[C@H]1N2C=C(C(=O)NC2=O)CO)COP(=O)(O)O)O |
| Solubility | 4.035e+004 mg/L (25 °C water) |
|---|---|
| Density | 1.7±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.615, Calc.* |
| Melting point | 90.27 °C |
| Boiling Point | 480.00 °C |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 5-Hydroxymethyldeoxyuridylate |