| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Classification | Analytical chemistry >> Standard >> Pharmacopoeia standards and magazine standards |
|---|---|
| Name | Oxeladin Citrate |
| Synonyms | 3-Carboxy-3,5-Dihydroxy-5-Oxo-Pentanoate; Diethyl-[2-[2-(2-Ethyl-2-Phenyl-Butanoyl)Oxyethoxy]Ethyl]Ammonium; 3-Carboxy-3,5-Dihydroxy-5-Oxopentanoate; Diethyl-[2-[2-(2-Ethyl-1-Oxo-2-Phenylbutoxy)Ethoxy]Ethyl]Ammonium; 3-Carboxy-3,5-Dihydroxy-5-Keto-Valerate; Diethyl-[2-[2-(2-Ethyl-2-Phenyl-Butanoyl)Oxyethoxy]Ethyl]Ammonium |
| Molecular Structure | ![]() |
| Molecular Formula | C26H41NO10 |
| Molecular Weight | 527.61 |
| CAS Registry Number | 52432-72-1 |
| EINECS | 257-910-8 |
| SMILES | C1=C(C(C(OCCOCC[NH+](CC)CC)=O)(CC)CC)C=CC=C1.C(C(O)(C(=O)O)CC(=O)O)C([O-])=O |
| InChI | 1S/C20H33NO3.C6H8O7/c1-5-20(6-2,18-12-10-9-11-13-18)19(22)24-17-16-23-15-14-21(7-3)8-4;7-3(8)1-6(13,5(11)12)2-4(9)10/h9-13H,5-8,14-17H2,1-4H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | KVKJFNUGVOFNGU-UHFFFAOYSA-N |
| Boiling point | 421.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 208.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Oxeladin Citrate |