Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| IRIS Biotech GmbH | Germany | Inquire | ||
|---|---|---|---|---|
|
+49 (9231) 961-973 | |||
|
info@iris-biotech.de | |||
| Chemical manufacturer since 1788 | ||||
| Name | 3',6'-Dimethoxy-[1,1':4',1''-Terphenyl]-2',4,4''-Triol |
|---|---|
| Synonyms | 2,5-Bis(4-Hydroxyphenyl)-3,6-Dimethoxy-Phenol; (1,1':4',1''-Terphenyl)-2',4,4''-Triol, 3',6'-Dimethoxy- (9Ci); Nsc 299114 |
| Molecular Structure | ![CAS#: 52452-60-5， 3',6'-Dimethoxy-[1,1':4',1''-Terphenyl]-2',4,4''-Triol](/moreStructures/52452-60-5.gif) |
| Molecular Formula | C20H18O5 |
| Molecular Weight | 338.36 |
| CAS Registry Number | 52452-60-5 |
| SMILES | C1=C(C(=C(C(=C1C2=CC=C(C=C2)O)OC)O)C3=CC=C(C=C3)O)OC |
| InChI | 1S/C20H18O5/c1-24-17-11-16(12-3-7-14(21)8-4-12)20(25-2)19(23)18(17)13-5-9-15(22)10-6-13/h3-11,21-23H,1-2H3 |
| InChIKey | YNEMPXKRLPZFAX-UHFFFAOYSA-N |
| Density | 1.285g/cm3 (Cal.) |
|---|---|
| Boiling point | 499.202°C at 760 mmHg (Cal.) |
| Flash point | 255.709°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3',6'-Dimethoxy-[1,1':4',1''-Terphenyl]-2',4,4''-Triol |